C35H45NO7S2 — CID 4157982
N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(3-methoxypropyl)thiophene-2-sulfonamide (PubChem CID 4157982) has the molecular formula C35H45NO7S2 and a molecular weight of 655.88 g/mol. Its IUPAC name is N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(3-methoxypropyl)thiophene-2-sulfonamide.
| Compound Name | N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(3-methoxypropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4157982 |
| Molecular Formula | C35H45NO7S2 |
| Molecular Weight | 655.88 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(3-methoxypropyl)thiophene-2-sulfonamide |
| SMILES | COCCCN(CC1(O)CCC2C34C=CC5(C=C3C(=O)c3ccco3)CC(O)CCC5(C)C4CCC21C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C35H45NO7S2/c1-31-12-9-24(37)21-33(31)15-16-35(25(22-33)30(38)26-7-4-19-43-26)27(31)10-13-32(2)28(35)11-14-34(32,39)23-36(17-6-18-42-3)45(40,41)29-8-5-20-44-29/h4-5,7-8,15-16,19-20,22,24,27-28,37,39H,6,9-14,17-18,21,23H2,1-3H3 |
| InChIKey | CEEWIKOXOUYSJB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.88 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|