C17H18N4O6S — CID 4158180
N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3,5-dinitrobenzamide (PubChem CID 4158180) has the molecular formula C17H18N4O6S and a molecular weight of 406.42 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3,5-dinitrobenzamide.
| Compound Name | N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4158180 |
| Molecular Formula | C17H18N4O6S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3,5-dinitrobenzamide |
| SMILES | O=C(NCC(c1cccs1)N1CCOCC1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H18N4O6S/c22-17(12-8-13(20(23)24)10-14(9-12)21(25)26)18-11-15(16-2-1-7-28-16)19-3-5-27-6-4-19/h1-2,7-10,15H,3-6,11H2,(H,18,22) |
| InChIKey | QLQQNGYCZGTTTG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|