C17H13ClFN3O3 — CID 4158621
N-(2-chloro-4-fluorophenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)butanamide (PubChem CID 4158621) has the molecular formula C17H13ClFN3O3 and a molecular weight of 361.76 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)butanamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)butanamide |
|---|---|
| PubChem CID | 4158621 |
| Molecular Formula | C17H13ClFN3O3 |
| Molecular Weight | 361.76 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2cccnc2C1=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H13ClFN3O3/c18-12-9-10(19)5-6-13(12)21-14(23)4-2-8-22-16(24)11-3-1-7-20-15(11)17(22)25/h1,3,5-7,9H,2,4,8H2,(H,21,23) |
| InChIKey | YAKXFEDKVYMBJD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.76 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|