C33H23F3I2N2O6 — CID 4159188
6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-2,8-bis(4-iodophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4159188) has the molecular formula C33H23F3I2N2O6 and a molecular weight of 854.36 g/mol. Its IUPAC name is 6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-2,8-bis(4-iodophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-2,8-bis(4-iodophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4159188 |
| Molecular Formula | C33H23F3I2N2O6 |
| Molecular Weight | 854.36 g/mol |
| Exact Mass | 853.96 |
| IUPAC Name | 6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-2,8-bis(4-iodophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(c5ccc(I)cc5)C(=O)C4C3c3cc(OC(F)(F)F)ccc3O)C2C(=O)N1c1ccc(I)cc1 |
| InChI | InChI=1S/C33H23F3I2N2O6/c34-33(35,36)46-19-9-12-25(41)23(13-19)26-20-10-11-21-27(31(44)39(29(21)42)17-5-1-15(37)2-6-17)22(20)14-24-28(26)32(45)40(30(24)43)18-7-3-16(38)4-8-18/h1-10,12-13,21-22,24,26-28,41H,11,14H2 |
| InChIKey | LHSCLSMUZHAPGT-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.36 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|