2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid

C12H11N3O5 — CID 4159214

IUPAC2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid
SMILESCOc1nc(OC)nc(Oc2ccccc2C(=O)O)n1
InChIInChI=1S/C12H11N3O5/c1-18-10-13-11(19-2)15-12(14-10)20-8-6-4-3-5-7(8)9(16)17/h3-6H,1-2H3,(H,16,17)
InChIKeyXOKYXMDEVQIBMR-UHFFFAOYSA-N
MW277.24 g/mol
LogP1.38
Rot. Bonds5

About 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid

2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid (PubChem CID 4159214) has the molecular formula C12H11N3O5 and a molecular weight of 277.24 g/mol. Its IUPAC name is 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid.

Molecular Properties

Compound Name2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid
PubChem CID4159214
Molecular FormulaC12H11N3O5
Molecular Weight277.24 g/mol
Exact Mass277.07
IUPAC Name2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid
SMILESCOc1nc(OC)nc(Oc2ccccc2C(=O)O)n1
InChIInChI=1S/C12H11N3O5/c1-18-10-13-11(19-2)15-12(14-10)20-8-6-4-3-5-7(8)9(16)17/h3-6H,1-2H3,(H,16,17)
InChIKeyXOKYXMDEVQIBMR-UHFFFAOYSA-N
XLogP1.38
TPSA103.66 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.24
LogP ≤ 51.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid?
The IUPAC name of 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid (CID 4159214) is 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid.
What is the SMILES notation for 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid?
The canonical SMILES for 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid is COc1nc(OC)nc(Oc2ccccc2C(=O)O)n1.
What is the InChIKey of 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid?
The InChIKey is XOKYXMDEVQIBMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O5/c1-18-10-13-11(19-2)15-12(14-10)20-8-6-4-3-5-7(8)9(16)17/h3-6H,1-2H3,(H,16,17).
What are the key properties of 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid?
2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid has a molecular weight of 277.24 g/mol, XLogP of 1.38, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoic acid is sourced from PubChem (CID 4159214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).