C16H15F4N5O5 — CID 4160611
[3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]methanone (PubChem CID 4160611) has the molecular formula C16H15F4N5O5 and a molecular weight of 433.32 g/mol. Its IUPAC name is [3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]methanone.
| Compound Name | [3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 4160611 |
| Molecular Formula | C16H15F4N5O5 |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | [3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]methanone |
| SMILES | Cc1nn(Cc2ccc(C(=O)N3N=C(C(F)F)CC3(O)C(F)F)o2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15F4N5O5/c1-7-12(25(28)29)8(2)23(21-7)6-9-3-4-11(30-9)14(26)24-16(27,15(19)20)5-10(22-24)13(17)18/h3-4,13,15,27H,5-6H2,1-2H3 |
| InChIKey | NTNFSMLRXCUIOB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|