C17H12ClNO3 — CID 4161793
N-[(4-chlorophenyl)methyl]-1-oxoisochromene-3-carboxamide (PubChem CID 4161793) has the molecular formula C17H12ClNO3 and a molecular weight of 313.74 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-1-oxoisochromene-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-1-oxoisochromene-3-carboxamide |
|---|---|
| PubChem CID | 4161793 |
| Molecular Formula | C17H12ClNO3 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-1-oxoisochromene-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1cc2ccccc2c(=O)o1 |
| InChI | InChI=1S/C17H12ClNO3/c18-13-7-5-11(6-8-13)10-19-16(20)15-9-12-3-1-2-4-14(12)17(21)22-15/h1-9H,10H2,(H,19,20) |
| InChIKey | RVZFXBMTJXQFRB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |