About 1-[2-(4-chlorophenyl)-6,8-dimethylquinolin-4-yl]-2-(dihexylamino)ethanol
1-[2-(4-chlorophenyl)-6,8-dimethylquinolin-4-yl]-2-(dihexylamino)ethanol (PubChem CID 4162665) has the molecular formula C31H43ClN2O
and a molecular weight of 495.15 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-6,8-dimethylquinolin-4-yl]-2-(dihexylamino)ethanol.
Molecular Properties
| Compound Name | 1-[2-(4-chlorophenyl)-6,8-dimethylquinolin-4-yl]-2-(dihexylamino)ethanol |
| PubChem CID | 4162665 |
| Molecular Formula | C31H43ClN2O |
| Molecular Weight | 495.15 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-6,8-dimethylquinolin-4-yl]-2-(dihexylamino)ethanol |
| SMILES | CCCCCCN(CCCCCC)CC(O)c1cc(-c2ccc(Cl)cc2)nc2c(C)cc(C)cc12 |
| InChI | InChI=1S/C31H43ClN2O/c1-5-7-9-11-17-34(18-12-10-8-6-2)22-30(35)27-21-29(25-13-15-26(32)16-14-25)33-31-24(4)19-23(3)20-28(27)31/h13-16,19-21,30,35H,5-12,17-18,22H2,1-4H3 |
| InChIKey | REJJTMLSIWBWAU-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.15 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(4-chlorophenyl)-6,8-dimethylquinolin-4-yl]-2-(dihexylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-chlorophenyl)-6,8-dimethylquinolin-4-yl]-2-(dihexylamino)ethanol?
The IUPAC name of 1-[2-(4-chlorophenyl)-6,8-dimethylquinolin-4-yl]-2-(dihexylamino)ethanol (CID 4162665) is 1-[2-(4-chlorophenyl)-6,8-dimethylquinolin-4-yl]-2-(dihexylamino)ethanol.
What is the SMILES notation for 1-[2-(4-chlorophenyl)-6,8-dimethylquinolin-4-yl]-2-(dihexylamino)ethanol?
The canonical SMILES for 1-[2-(4-chlorophenyl)-6,8-dimethylquinolin-4-yl]-2-(dihexylamino)ethanol is CCCCCCN(CCCCCC)CC(O)c1cc(-c2ccc(Cl)cc2)nc2c(C)cc(C)cc12.
What is the InChIKey of 1-[2-(4-chlorophenyl)-6,8-dimethylquinolin-4-yl]-2-(dihexylamino)ethanol?
The InChIKey is REJJTMLSIWBWAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H43ClN2O/c1-5-7-9-11-17-34(18-12-10-8-6-2)22-30(35)27-21-29(25-13-15-26(32)16-14-25)33-31-24(4)19-23(3)20-28(27)31/h13-16,19-21,30,35H,5-12,17-18,22H2,1-4H3.
What are the key properties of 1-[2-(4-chlorophenyl)-6,8-dimethylquinolin-4-yl]-2-(dihexylamino)ethanol?
1-[2-(4-chlorophenyl)-6,8-dimethylquinolin-4-yl]-2-(dihexylamino)ethanol has a molecular weight of 495.15 g/mol, XLogP of 8.67, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-chlorophenyl)-6,8-dimethylquinolin-4-yl]-2-(dihexylamino)ethanol is sourced from PubChem (CID 4162665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).