C20H16Cl2N4O2S2 — CID 4163150
3,4-dichloro-N-[2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]benzenesulfonamide (PubChem CID 4163150) has the molecular formula C20H16Cl2N4O2S2 and a molecular weight of 479.41 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4163150 |
| Molecular Formula | C20H16Cl2N4O2S2 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | 3,4-dichloro-N-[2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1ncnc2scc(-c3ccccc3)c12)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H16Cl2N4O2S2/c21-16-7-6-14(10-17(16)22)30(27,28)26-9-8-23-19-18-15(13-4-2-1-3-5-13)11-29-20(18)25-12-24-19/h1-7,10-12,26H,8-9H2,(H,23,24,25) |
| InChIKey | MAYPWVJIOPMZCO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|