C12H21N5OS — CID 4163821
1-butyl-3-[3-(4-methylpyrazol-1-yl)propanoylamino]thiourea (PubChem CID 4163821) has the molecular formula C12H21N5OS and a molecular weight of 283.40 g/mol. Its IUPAC name is 1-butyl-3-[3-(4-methylpyrazol-1-yl)propanoylamino]thiourea.
| Compound Name | 1-butyl-3-[3-(4-methylpyrazol-1-yl)propanoylamino]thiourea |
|---|---|
| PubChem CID | 4163821 |
| Molecular Formula | C12H21N5OS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-butyl-3-[3-(4-methylpyrazol-1-yl)propanoylamino]thiourea |
| SMILES | CCCCNC(=S)NNC(=O)CCn1cc(C)cn1 |
| InChI | InChI=1S/C12H21N5OS/c1-3-4-6-13-12(19)16-15-11(18)5-7-17-9-10(2)8-14-17/h8-9H,3-7H2,1-2H3,(H,15,18)(H2,13,16,19) |
| InChIKey | BHVPORGALVOMEH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|