About 2-benzylpropanediamide
2-benzylpropanediamide (PubChem CID 4163944) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-benzylpropanediamide.
Molecular Properties
| Compound Name | 2-benzylpropanediamide |
| PubChem CID | 4163944 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-benzylpropanediamide |
| SMILES | NC(=O)C(Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C10H12N2O2/c11-9(13)8(10(12)14)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,11,13)(H2,12,14) |
| InChIKey | RBRUESIJXFRMJA-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-benzylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylpropanediamide?
The IUPAC name of 2-benzylpropanediamide (CID 4163944) is 2-benzylpropanediamide.
What is the SMILES notation for 2-benzylpropanediamide?
The canonical SMILES for 2-benzylpropanediamide is NC(=O)C(Cc1ccccc1)C(N)=O.
What is the InChIKey of 2-benzylpropanediamide?
The InChIKey is RBRUESIJXFRMJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c11-9(13)8(10(12)14)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,11,13)(H2,12,14).
What are the key properties of 2-benzylpropanediamide?
2-benzylpropanediamide has a molecular weight of 192.22 g/mol, XLogP of -0.18, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylpropanediamide is sourced from PubChem (CID 4163944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).