C10H12N2O — CID 4164358
2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenol (PubChem CID 4164358) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenol.
| Compound Name | 2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenol |
|---|---|
| PubChem CID | 4164358 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenol |
| SMILES | Oc1ccccc1C1=NCCCN1 |
| InChI | InChI=1S/C10H12N2O/c13-9-5-2-1-4-8(9)10-11-6-3-7-12-10/h1-2,4-5,13H,3,6-7H2,(H,11,12) |
| InChIKey | ASEAXFLYJBVEGB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |