C27H16Cl2F3N3O3S — CID 4164682
2-[5-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 4164682) has the molecular formula C27H16Cl2F3N3O3S and a molecular weight of 590.41 g/mol. Its IUPAC name is 2-[5-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[5-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 4164682 |
| Molecular Formula | C27H16Cl2F3N3O3S |
| Molecular Weight | 590.41 g/mol |
| Exact Mass | 589.02 |
| IUPAC Name | 2-[5-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)SC(=Cc2cn(Cc3c(Cl)cccc3Cl)c3ccccc23)C1=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C27H16Cl2F3N3O3S/c28-17-5-3-6-18(29)16(17)12-34-11-14(15-4-1-2-7-21(15)34)10-22-26(37)35(27(38)39-22)13-23(36)33-20-9-8-19(30)24(31)25(20)32/h1-11H,12-13H2,(H,33,36) |
| InChIKey | CKSILCIQEPNIQZ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.41 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|