About 6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole
6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole (PubChem CID 4164759) has the molecular formula C9H6N2S2
and a molecular weight of 206.30 g/mol. Its IUPAC name is 6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole |
| PubChem CID | 4164759 |
| Molecular Formula | C9H6N2S2 |
| Molecular Weight | 206.30 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | 6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole |
| SMILES | c1csc(-c2cn3ccsc3n2)c1 |
| InChI | InChI=1S/C9H6N2S2/c1-2-8(12-4-1)7-6-11-3-5-13-9(11)10-7/h1-6H |
| InChIKey | YKINBJCTANWRJC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole?
The IUPAC name of 6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole (CID 4164759) is 6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for 6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole?
The canonical SMILES for 6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole is c1csc(-c2cn3ccsc3n2)c1.
What is the InChIKey of 6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole?
The InChIKey is YKINBJCTANWRJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2S2/c1-2-8(12-4-1)7-6-11-3-5-13-9(11)10-7/h1-6H.
What are the key properties of 6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole?
6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole has a molecular weight of 206.30 g/mol, XLogP of 3.12, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 4164759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).