About 3-(benzylamino)-2,2-difluoro-3-phenylpropanoic acid
3-(benzylamino)-2,2-difluoro-3-phenylpropanoic acid (PubChem CID 4164890) has the molecular formula C16H15F2NO2
and a molecular weight of 291.30 g/mol. Its IUPAC name is 3-(benzylamino)-2,2-difluoro-3-phenylpropanoic acid.
Molecular Properties
| Compound Name | 3-(benzylamino)-2,2-difluoro-3-phenylpropanoic acid |
| PubChem CID | 4164890 |
| Molecular Formula | C16H15F2NO2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-(benzylamino)-2,2-difluoro-3-phenylpropanoic acid |
| SMILES | O=C(O)C(F)(F)C(NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15F2NO2/c17-16(18,15(20)21)14(13-9-5-2-6-10-13)19-11-12-7-3-1-4-8-12/h1-10,14,19H,11H2,(H,20,21) |
| InChIKey | IQOOVWKNDOJFNN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(benzylamino)-2,2-difluoro-3-phenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzylamino)-2,2-difluoro-3-phenylpropanoic acid?
The IUPAC name of 3-(benzylamino)-2,2-difluoro-3-phenylpropanoic acid (CID 4164890) is 3-(benzylamino)-2,2-difluoro-3-phenylpropanoic acid.
What is the SMILES notation for 3-(benzylamino)-2,2-difluoro-3-phenylpropanoic acid?
The canonical SMILES for 3-(benzylamino)-2,2-difluoro-3-phenylpropanoic acid is O=C(O)C(F)(F)C(NCc1ccccc1)c1ccccc1.
What is the InChIKey of 3-(benzylamino)-2,2-difluoro-3-phenylpropanoic acid?
The InChIKey is IQOOVWKNDOJFNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F2NO2/c17-16(18,15(20)21)14(13-9-5-2-6-10-13)19-11-12-7-3-1-4-8-12/h1-10,14,19H,11H2,(H,20,21).
What are the key properties of 3-(benzylamino)-2,2-difluoro-3-phenylpropanoic acid?
3-(benzylamino)-2,2-difluoro-3-phenylpropanoic acid has a molecular weight of 291.30 g/mol, XLogP of 3.24, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzylamino)-2,2-difluoro-3-phenylpropanoic acid is sourced from PubChem (CID 4164890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).