C14H16Cl3NO3S — CID 4165077
methyl 2-[(2,2,2-trichloroacetyl)amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 4165077) has the molecular formula C14H16Cl3NO3S and a molecular weight of 384.71 g/mol. Its IUPAC name is methyl 2-[(2,2,2-trichloroacetyl)amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(2,2,2-trichloroacetyl)amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4165077 |
| Molecular Formula | C14H16Cl3NO3S |
| Molecular Weight | 384.71 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | methyl 2-[(2,2,2-trichloroacetyl)amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(Cl)(Cl)Cl)sc2c1CCCCCC2 |
| InChI | InChI=1S/C14H16Cl3NO3S/c1-21-12(19)10-8-6-4-2-3-5-7-9(8)22-11(10)18-13(20)14(15,16)17/h2-7H2,1H3,(H,18,20) |
| InChIKey | VYZFEZGRVJRZCZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.71 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|