C7H16N4S — CID 4165553
6-butyl-6-methyl-1,2,4,5-tetrazinane-3-thione (PubChem CID 4165553) has the molecular formula C7H16N4S and a molecular weight of 188.30 g/mol. Its IUPAC name is 6-butyl-6-methyl-1,2,4,5-tetrazinane-3-thione.
| Compound Name | 6-butyl-6-methyl-1,2,4,5-tetrazinane-3-thione |
|---|---|
| PubChem CID | 4165553 |
| Molecular Formula | C7H16N4S |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 6-butyl-6-methyl-1,2,4,5-tetrazinane-3-thione |
| SMILES | CCCCC1(C)NNC(=S)NN1 |
| InChI | InChI=1S/C7H16N4S/c1-3-4-5-7(2)10-8-6(12)9-11-7/h10-11H,3-5H2,1-2H3,(H2,8,9,12) |
| InChIKey | DBYSCIQKUJKKEA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_F(6)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|