About 4-methoxy-3,5-dimethylaniline
4-methoxy-3,5-dimethylaniline (PubChem CID 4166097) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-methoxy-3,5-dimethylaniline.
Molecular Properties
| Compound Name | 4-methoxy-3,5-dimethylaniline |
| PubChem CID | 4166097 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 4-methoxy-3,5-dimethylaniline |
| SMILES | COc1c(C)cc(N)cc1C |
| InChI | InChI=1S/C9H13NO/c1-6-4-8(10)5-7(2)9(6)11-3/h4-5H,10H2,1-3H3 |
| InChIKey | HUPGZEYAAFYLSC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-3,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3,5-dimethylaniline?
The IUPAC name of 4-methoxy-3,5-dimethylaniline (CID 4166097) is 4-methoxy-3,5-dimethylaniline.
What is the SMILES notation for 4-methoxy-3,5-dimethylaniline?
The canonical SMILES for 4-methoxy-3,5-dimethylaniline is COc1c(C)cc(N)cc1C.
What is the InChIKey of 4-methoxy-3,5-dimethylaniline?
The InChIKey is HUPGZEYAAFYLSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-6-4-8(10)5-7(2)9(6)11-3/h4-5H,10H2,1-3H3.
What are the key properties of 4-methoxy-3,5-dimethylaniline?
4-methoxy-3,5-dimethylaniline has a molecular weight of 151.21 g/mol, XLogP of 1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3,5-dimethylaniline is sourced from PubChem (CID 4166097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).