About 1,3-bis(2-hydroxyethyl)pyrimidine-2,4-dione
1,3-bis(2-hydroxyethyl)pyrimidine-2,4-dione (PubChem CID 4166253) has the molecular formula C8H12N2O4
and a molecular weight of 200.19 g/mol. Its IUPAC name is 1,3-bis(2-hydroxyethyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1,3-bis(2-hydroxyethyl)pyrimidine-2,4-dione |
| PubChem CID | 4166253 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 1,3-bis(2-hydroxyethyl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn(CCO)c(=O)n1CCO |
| InChI | InChI=1S/C8H12N2O4/c11-5-3-9-2-1-7(13)10(4-6-12)8(9)14/h1-2,11-12H,3-6H2 |
| InChIKey | AKEISPWDGKTJAB-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3-bis(2-hydroxyethyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(2-hydroxyethyl)pyrimidine-2,4-dione?
The IUPAC name of 1,3-bis(2-hydroxyethyl)pyrimidine-2,4-dione (CID 4166253) is 1,3-bis(2-hydroxyethyl)pyrimidine-2,4-dione.
What is the SMILES notation for 1,3-bis(2-hydroxyethyl)pyrimidine-2,4-dione?
The canonical SMILES for 1,3-bis(2-hydroxyethyl)pyrimidine-2,4-dione is O=c1ccn(CCO)c(=O)n1CCO.
What is the InChIKey of 1,3-bis(2-hydroxyethyl)pyrimidine-2,4-dione?
The InChIKey is AKEISPWDGKTJAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4/c11-5-3-9-2-1-7(13)10(4-6-12)8(9)14/h1-2,11-12H,3-6H2.
What are the key properties of 1,3-bis(2-hydroxyethyl)pyrimidine-2,4-dione?
1,3-bis(2-hydroxyethyl)pyrimidine-2,4-dione has a molecular weight of 200.19 g/mol, XLogP of -2.01, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(2-hydroxyethyl)pyrimidine-2,4-dione is sourced from PubChem (CID 4166253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).