About N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)bicyclo[2.2.1]heptane-1-carboxamide
N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)bicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 4166689) has the molecular formula C21H21N3O
and a molecular weight of 331.42 g/mol. Its IUPAC name is N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)bicyclo[2.2.1]heptane-1-carboxamide.
Molecular Properties
| Compound Name | N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)bicyclo[2.2.1]heptane-1-carboxamide |
| PubChem CID | 4166689 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)bicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | O=C(/N=C1\N=C2C=CC=CN2Cc2ccccc21)C12CCC(CC1)C2 |
| InChI | InChI=1S/C21H21N3O/c25-20(21-10-8-15(13-21)9-11-21)23-19-17-6-2-1-5-16(17)14-24-12-4-3-7-18(24)22-19/h1-7,12,15H,8-11,13-14H2/b23-19- |
| InChIKey | UBGOTERVGNYXCV-NMWGTECJSA-N |
| XLogP | 3.84 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)bicyclo[2.2.1]heptane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)bicyclo[2.2.1]heptane-1-carboxamide?
The IUPAC name of N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)bicyclo[2.2.1]heptane-1-carboxamide (CID 4166689) is N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)bicyclo[2.2.1]heptane-1-carboxamide.
What is the SMILES notation for N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)bicyclo[2.2.1]heptane-1-carboxamide?
The canonical SMILES for N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)bicyclo[2.2.1]heptane-1-carboxamide is O=C(/N=C1\N=C2C=CC=CN2Cc2ccccc21)C12CCC(CC1)C2.
What is the InChIKey of N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)bicyclo[2.2.1]heptane-1-carboxamide?
The InChIKey is UBGOTERVGNYXCV-NMWGTECJSA-N. The full InChI is InChI=1S/C21H21N3O/c25-20(21-10-8-15(13-21)9-11-21)23-19-17-6-2-1-5-16(17)14-24-12-4-3-7-18(24)22-19/h1-7,12,15H,8-11,13-14H2/b23-19-.
What are the key properties of N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)bicyclo[2.2.1]heptane-1-carboxamide?
N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)bicyclo[2.2.1]heptane-1-carboxamide has a molecular weight of 331.42 g/mol, XLogP of 3.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)bicyclo[2.2.1]heptane-1-carboxamide is sourced from PubChem (CID 4166689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).