C23H24N2O2 — CID 4167053
1,1-dibenzyl-3-(2-methoxy-5-methylphenyl)urea (PubChem CID 4167053) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1,1-dibenzyl-3-(2-methoxy-5-methylphenyl)urea.
| Compound Name | 1,1-dibenzyl-3-(2-methoxy-5-methylphenyl)urea |
|---|---|
| PubChem CID | 4167053 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 1,1-dibenzyl-3-(2-methoxy-5-methylphenyl)urea |
| SMILES | COc1ccc(C)cc1NC(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H24N2O2/c1-18-13-14-22(27-2)21(15-18)24-23(26)25(16-19-9-5-3-6-10-19)17-20-11-7-4-8-12-20/h3-15H,16-17H2,1-2H3,(H,24,26) |
| InChIKey | QENSTJKJSDMWLV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |