C11H12F6N2O2 — CID 4167175
2,2,3,3,4,4-hexafluoro-N,N'-bis(prop-2-enyl)pentanediamide (PubChem CID 4167175) has the molecular formula C11H12F6N2O2 and a molecular weight of 318.22 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-N,N'-bis(prop-2-enyl)pentanediamide.
| Compound Name | 2,2,3,3,4,4-hexafluoro-N,N'-bis(prop-2-enyl)pentanediamide |
|---|---|
| PubChem CID | 4167175 |
| Molecular Formula | C11H12F6N2O2 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-N,N'-bis(prop-2-enyl)pentanediamide |
| SMILES | C=CCNC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)NCC=C |
| InChI | InChI=1S/C11H12F6N2O2/c1-3-5-18-7(20)9(12,13)11(16,17)10(14,15)8(21)19-6-4-2/h3-4H,1-2,5-6H2,(H,18,20)(H,19,21) |
| InChIKey | HTUSORDPRXZKCU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|