About 2,6-ditert-butyl-4-[2-(2,4-dichlorophenyl)-5-methoxybenzimidazol-1-yl]phenol
2,6-ditert-butyl-4-[2-(2,4-dichlorophenyl)-5-methoxybenzimidazol-1-yl]phenol (PubChem CID 4167233) has the molecular formula C28H30Cl2N2O2
and a molecular weight of 497.47 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2-(2,4-dichlorophenyl)-5-methoxybenzimidazol-1-yl]phenol.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-4-[2-(2,4-dichlorophenyl)-5-methoxybenzimidazol-1-yl]phenol |
| PubChem CID | 4167233 |
| Molecular Formula | C28H30Cl2N2O2 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 2,6-ditert-butyl-4-[2-(2,4-dichlorophenyl)-5-methoxybenzimidazol-1-yl]phenol |
| SMILES | COc1ccc2c(c1)nc(-c1ccc(Cl)cc1Cl)n2-c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H30Cl2N2O2/c1-27(2,3)20-13-17(14-21(25(20)33)28(4,5)6)32-24-11-9-18(34-7)15-23(24)31-26(32)19-10-8-16(29)12-22(19)30/h8-15,33H,1-7H3 |
| InChIKey | WGKUNHJXIMFPPE-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-ditert-butyl-4-[2-(2,4-dichlorophenyl)-5-methoxybenzimidazol-1-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-4-[2-(2,4-dichlorophenyl)-5-methoxybenzimidazol-1-yl]phenol?
The IUPAC name of 2,6-ditert-butyl-4-[2-(2,4-dichlorophenyl)-5-methoxybenzimidazol-1-yl]phenol (CID 4167233) is 2,6-ditert-butyl-4-[2-(2,4-dichlorophenyl)-5-methoxybenzimidazol-1-yl]phenol.
What is the SMILES notation for 2,6-ditert-butyl-4-[2-(2,4-dichlorophenyl)-5-methoxybenzimidazol-1-yl]phenol?
The canonical SMILES for 2,6-ditert-butyl-4-[2-(2,4-dichlorophenyl)-5-methoxybenzimidazol-1-yl]phenol is COc1ccc2c(c1)nc(-c1ccc(Cl)cc1Cl)n2-c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2,6-ditert-butyl-4-[2-(2,4-dichlorophenyl)-5-methoxybenzimidazol-1-yl]phenol?
The InChIKey is WGKUNHJXIMFPPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30Cl2N2O2/c1-27(2,3)20-13-17(14-21(25(20)33)28(4,5)6)32-24-11-9-18(34-7)15-23(24)31-26(32)19-10-8-16(29)12-22(19)30/h8-15,33H,1-7H3.
What are the key properties of 2,6-ditert-butyl-4-[2-(2,4-dichlorophenyl)-5-methoxybenzimidazol-1-yl]phenol?
2,6-ditert-butyl-4-[2-(2,4-dichlorophenyl)-5-methoxybenzimidazol-1-yl]phenol has a molecular weight of 497.47 g/mol, XLogP of 8.31, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-4-[2-(2,4-dichlorophenyl)-5-methoxybenzimidazol-1-yl]phenol is sourced from PubChem (CID 4167233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).