About tridecanamide
tridecanamide (PubChem CID 4167542) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is tridecanamide.
Molecular Properties
| Compound Name | tridecanamide |
| PubChem CID | 4167542 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | tridecanamide |
| SMILES | CCCCCCCCCCCCC(N)=O |
| InChI | InChI=1S/C13H27NO/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-12H2,1H3,(H2,14,15) |
| InChIKey | RSSGSPAYFRXVKG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tridecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tridecanamide?
The IUPAC name of tridecanamide (CID 4167542) is tridecanamide.
What is the SMILES notation for tridecanamide?
The canonical SMILES for tridecanamide is CCCCCCCCCCCCC(N)=O.
What is the InChIKey of tridecanamide?
The InChIKey is RSSGSPAYFRXVKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-12H2,1H3,(H2,14,15).
What are the key properties of tridecanamide?
tridecanamide has a molecular weight of 213.36 g/mol, XLogP of 3.78, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tridecanamide is sourced from PubChem (CID 4167542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).