C20H22N2O4S — CID 4168025
3-(4-methylphenyl)-2-sulfanylidene-1-[(3,4,5-trimethoxyphenyl)methyl]imidazolidin-4-one (PubChem CID 4168025) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 3-(4-methylphenyl)-2-sulfanylidene-1-[(3,4,5-trimethoxyphenyl)methyl]imidazolidin-4-one.
| Compound Name | 3-(4-methylphenyl)-2-sulfanylidene-1-[(3,4,5-trimethoxyphenyl)methyl]imidazolidin-4-one |
|---|---|
| PubChem CID | 4168025 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 3-(4-methylphenyl)-2-sulfanylidene-1-[(3,4,5-trimethoxyphenyl)methyl]imidazolidin-4-one |
| SMILES | COc1cc(CN2CC(=O)N(c3ccc(C)cc3)C2=S)cc(OC)c1OC |
| InChI | InChI=1S/C20H22N2O4S/c1-13-5-7-15(8-6-13)22-18(23)12-21(20(22)27)11-14-9-16(24-2)19(26-4)17(10-14)25-3/h5-10H,11-12H2,1-4H3 |
| InChIKey | YVHHBUDMSIKEBT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|