About 6-(4-chlorophenyl)-N,N,2-trimethylhexa-3,5-diyn-2-amine
6-(4-chlorophenyl)-N,N,2-trimethylhexa-3,5-diyn-2-amine (PubChem CID 4168058) has the molecular formula C15H16ClN
and a molecular weight of 245.75 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N,N,2-trimethylhexa-3,5-diyn-2-amine.
Molecular Properties
| Compound Name | 6-(4-chlorophenyl)-N,N,2-trimethylhexa-3,5-diyn-2-amine |
| PubChem CID | 4168058 |
| Molecular Formula | C15H16ClN |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 6-(4-chlorophenyl)-N,N,2-trimethylhexa-3,5-diyn-2-amine |
| SMILES | CN(C)C(C)(C)C#CC#Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16ClN/c1-15(2,17(3)4)12-6-5-7-13-8-10-14(16)11-9-13/h8-11H,1-4H3 |
| InChIKey | QRHOUCNJONVMBI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-chlorophenyl)-N,N,2-trimethylhexa-3,5-diyn-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorophenyl)-N,N,2-trimethylhexa-3,5-diyn-2-amine?
The IUPAC name of 6-(4-chlorophenyl)-N,N,2-trimethylhexa-3,5-diyn-2-amine (CID 4168058) is 6-(4-chlorophenyl)-N,N,2-trimethylhexa-3,5-diyn-2-amine.
What is the SMILES notation for 6-(4-chlorophenyl)-N,N,2-trimethylhexa-3,5-diyn-2-amine?
The canonical SMILES for 6-(4-chlorophenyl)-N,N,2-trimethylhexa-3,5-diyn-2-amine is CN(C)C(C)(C)C#CC#Cc1ccc(Cl)cc1.
What is the InChIKey of 6-(4-chlorophenyl)-N,N,2-trimethylhexa-3,5-diyn-2-amine?
The InChIKey is QRHOUCNJONVMBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClN/c1-15(2,17(3)4)12-6-5-7-13-8-10-14(16)11-9-13/h8-11H,1-4H3.
What are the key properties of 6-(4-chlorophenyl)-N,N,2-trimethylhexa-3,5-diyn-2-amine?
6-(4-chlorophenyl)-N,N,2-trimethylhexa-3,5-diyn-2-amine has a molecular weight of 245.75 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorophenyl)-N,N,2-trimethylhexa-3,5-diyn-2-amine is sourced from PubChem (CID 4168058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).