C38H27Br2ClFN3O5 — CID 4168298
6-(5-bromo-2-hydroxyphenyl)-2-(4-bromophenyl)-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4168298) has the molecular formula C38H27Br2ClFN3O5 and a molecular weight of 819.91 g/mol. Its IUPAC name is 6-(5-bromo-2-hydroxyphenyl)-2-(4-bromophenyl)-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(5-bromo-2-hydroxyphenyl)-2-(4-bromophenyl)-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4168298 |
| Molecular Formula | C38H27Br2ClFN3O5 |
| Molecular Weight | 819.91 g/mol |
| Exact Mass | 817.00 |
| IUPAC Name | 6-(5-bromo-2-hydroxyphenyl)-2-(4-bromophenyl)-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC3C(=CCC4C(=O)N(c5ccc(Br)cc5)C(=O)C43)C(c3cc(Br)ccc3O)C2(c2ccc(Cl)cc2)C(=O)N1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C38H27Br2ClFN3O5/c39-20-3-12-25(13-4-20)44-34(47)27-15-14-26-28(32(27)36(44)49)18-30-35(48)45(43-24-10-8-23(42)9-11-24)37(50)38(30,19-1-6-22(41)7-2-19)33(26)29-17-21(40)5-16-31(29)46/h1-14,16-17,27-28,30,32-33,43,46H,15,18H2 |
| InChIKey | AQXTYMPQCGZDDO-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.91 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|