C23H20N4O3S — CID 4168621
5-[4-(4-acetylphenyl)piperazine-1-carbonyl]-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one (PubChem CID 4168621) has the molecular formula C23H20N4O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is 5-[4-(4-acetylphenyl)piperazine-1-carbonyl]-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one.
| Compound Name | 5-[4-(4-acetylphenyl)piperazine-1-carbonyl]-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
|---|---|
| PubChem CID | 4168621 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 5-[4-(4-acetylphenyl)piperazine-1-carbonyl]-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)c3cc4c(=O)n5ccccc5nc4s3)CC2)cc1 |
| InChI | InChI=1S/C23H20N4O3S/c1-15(28)16-5-7-17(8-6-16)25-10-12-26(13-11-25)23(30)19-14-18-21(31-19)24-20-4-2-3-9-27(20)22(18)29/h2-9,14H,10-13H2,1H3 |
| InChIKey | UOSSNZWWKCWXNS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |