C17H20N2S — CID 4168985
4-(2,3-dihydro-1,3-benzothiazol-2-yl)-N,N-diethylaniline (PubChem CID 4168985) has the molecular formula C17H20N2S and a molecular weight of 284.43 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,3-benzothiazol-2-yl)-N,N-diethylaniline.
| Compound Name | 4-(2,3-dihydro-1,3-benzothiazol-2-yl)-N,N-diethylaniline |
|---|---|
| PubChem CID | 4168985 |
| Molecular Formula | C17H20N2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4-(2,3-dihydro-1,3-benzothiazol-2-yl)-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C2Nc3ccccc3S2)cc1 |
| InChI | InChI=1S/C17H20N2S/c1-3-19(4-2)14-11-9-13(10-12-14)17-18-15-7-5-6-8-16(15)20-17/h5-12,17-18H,3-4H2,1-2H3 |
| InChIKey | PZDAADHPGBTCCU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |