C22H19N3O — CID 4169133
1-(2,3,4-triphenyl-3H-1,2,4-triazol-5-yl)ethanone (PubChem CID 4169133) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-(2,3,4-triphenyl-3H-1,2,4-triazol-5-yl)ethanone.
| Compound Name | 1-(2,3,4-triphenyl-3H-1,2,4-triazol-5-yl)ethanone |
|---|---|
| PubChem CID | 4169133 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-(2,3,4-triphenyl-3H-1,2,4-triazol-5-yl)ethanone |
| SMILES | CC(=O)C1=NN(c2ccccc2)C(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C22H19N3O/c1-17(26)21-23-25(20-15-9-4-10-16-20)22(18-11-5-2-6-12-18)24(21)19-13-7-3-8-14-19/h2-16,22H,1H3 |
| InChIKey | ITMWOAQPJMNDKV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |