C20H15N3O4 — CID 4169695
2-(furan-2-yl)-5,7-dimethyl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,13,15-pentaene-4,6,17-trione (PubChem CID 4169695) has the molecular formula C20H15N3O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is 2-(furan-2-yl)-5,7-dimethyl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,13,15-pentaene-4,6,17-trione.
| Compound Name | 2-(furan-2-yl)-5,7-dimethyl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,13,15-pentaene-4,6,17-trione |
|---|---|
| PubChem CID | 4169695 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-(furan-2-yl)-5,7-dimethyl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,13,15-pentaene-4,6,17-trione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)C(c1ccco1)C1C(=O)c3ccccc3C1=N2 |
| InChI | InChI=1S/C20H15N3O4/c1-22-18-15(19(25)23(2)20(22)26)13(12-8-5-9-27-12)14-16(21-18)10-6-3-4-7-11(10)17(14)24/h3-9,13-14H,1-2H3 |
| InChIKey | GLEJBHUUHOMJAH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 86.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |