About ethyl 5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylate
ethyl 5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylate (PubChem CID 4170118) has the molecular formula C13H14O3
and a molecular weight of 218.25 g/mol. Its IUPAC name is ethyl 5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylate |
| PubChem CID | 4170118 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | ethyl 5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylate |
| SMILES | CCOC(=O)C12C=CC(=O)C1C1C=CC2C1 |
| InChI | InChI=1S/C13H14O3/c1-2-16-12(15)13-6-5-10(14)11(13)8-3-4-9(13)7-8/h3-6,8-9,11H,2,7H2,1H3 |
| InChIKey | ZYKKBCZKDGUTCM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylate?
The IUPAC name of ethyl 5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylate (CID 4170118) is ethyl 5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylate.
What is the SMILES notation for ethyl 5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylate?
The canonical SMILES for ethyl 5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylate is CCOC(=O)C12C=CC(=O)C1C1C=CC2C1.
What is the InChIKey of ethyl 5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylate?
The InChIKey is ZYKKBCZKDGUTCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O3/c1-2-16-12(15)13-6-5-10(14)11(13)8-3-4-9(13)7-8/h3-6,8-9,11H,2,7H2,1H3.
What are the key properties of ethyl 5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylate?
ethyl 5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylate has a molecular weight of 218.25 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylate is sourced from PubChem (CID 4170118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).