About 3-(2-chlorophenyl)-1,1-di(propan-2-yl)urea
3-(2-chlorophenyl)-1,1-di(propan-2-yl)urea (PubChem CID 4171803) has the molecular formula C13H19ClN2O
and a molecular weight of 254.76 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1,1-di(propan-2-yl)urea.
Molecular Properties
| Compound Name | 3-(2-chlorophenyl)-1,1-di(propan-2-yl)urea |
| PubChem CID | 4171803 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-(2-chlorophenyl)-1,1-di(propan-2-yl)urea |
| SMILES | CC(C)N(C(=O)Nc1ccccc1Cl)C(C)C |
| InChI | InChI=1S/C13H19ClN2O/c1-9(2)16(10(3)4)13(17)15-12-8-6-5-7-11(12)14/h5-10H,1-4H3,(H,15,17) |
| InChIKey | RIIDSSDXCJINLM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2-chlorophenyl)-1,1-di(propan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chlorophenyl)-1,1-di(propan-2-yl)urea?
The IUPAC name of 3-(2-chlorophenyl)-1,1-di(propan-2-yl)urea (CID 4171803) is 3-(2-chlorophenyl)-1,1-di(propan-2-yl)urea.
What is the SMILES notation for 3-(2-chlorophenyl)-1,1-di(propan-2-yl)urea?
The canonical SMILES for 3-(2-chlorophenyl)-1,1-di(propan-2-yl)urea is CC(C)N(C(=O)Nc1ccccc1Cl)C(C)C.
What is the InChIKey of 3-(2-chlorophenyl)-1,1-di(propan-2-yl)urea?
The InChIKey is RIIDSSDXCJINLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClN2O/c1-9(2)16(10(3)4)13(17)15-12-8-6-5-7-11(12)14/h5-10H,1-4H3,(H,15,17).
What are the key properties of 3-(2-chlorophenyl)-1,1-di(propan-2-yl)urea?
3-(2-chlorophenyl)-1,1-di(propan-2-yl)urea has a molecular weight of 254.76 g/mol, XLogP of 3.99, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chlorophenyl)-1,1-di(propan-2-yl)urea is sourced from PubChem (CID 4171803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).