C36H57NO6 — CID 4171920
cyclohexyl-[5-[[2,3-dihydroxypropyl(3-methoxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 4171920) has the molecular formula C36H57NO6 and a molecular weight of 599.85 g/mol. Its IUPAC name is cyclohexyl-[5-[[2,3-dihydroxypropyl(3-methoxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | cyclohexyl-[5-[[2,3-dihydroxypropyl(3-methoxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 4171920 |
| Molecular Formula | C36H57NO6 |
| Molecular Weight | 599.85 g/mol |
| Exact Mass | 599.42 |
| IUPAC Name | cyclohexyl-[5-[[2,3-dihydroxypropyl(3-methoxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | COCCCN(CC(O)CO)CC1(O)CCC2C34C=CC5(C=C3C(=O)C3CCCCC3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C36H57NO6/c1-32-13-10-26(39)20-34(32)16-17-36(28(21-34)31(41)25-8-5-4-6-9-25)29(32)11-14-33(2)30(36)12-15-35(33,42)24-37(18-7-19-43-3)22-27(40)23-38/h16-17,21,25-27,29-30,38-40,42H,4-15,18-20,22-24H2,1-3H3 |
| InChIKey | AXSGPNZPNUEHNF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.85 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|