C15H15NO — CID 4171921
3,6-dimethyl-5,6-dihydrobenzo[b][1,4]benzoxazepine (PubChem CID 4171921) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 3,6-dimethyl-5,6-dihydrobenzo[b][1,4]benzoxazepine.
| Compound Name | 3,6-dimethyl-5,6-dihydrobenzo[b][1,4]benzoxazepine |
|---|---|
| PubChem CID | 4171921 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 3,6-dimethyl-5,6-dihydrobenzo[b][1,4]benzoxazepine |
| SMILES | Cc1ccc2c(c1)NC(C)c1ccccc1O2 |
| InChI | InChI=1S/C15H15NO/c1-10-7-8-15-13(9-10)16-11(2)12-5-3-4-6-14(12)17-15/h3-9,11,16H,1-2H3 |
| InChIKey | VHYFVQFTEKAQKD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |