About 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium
2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium (PubChem CID 4172110) has the molecular formula C11H16NO2S+
and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium |
| PubChem CID | 4172110 |
| Molecular Formula | C11H16NO2S+ |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium |
| SMILES | COc1ccc(C2[NH2+]CCS2)cc1OC |
| InChI | InChI=1S/C11H15NO2S/c1-13-9-4-3-8(7-10(9)14-2)11-12-5-6-15-11/h3-4,7,11-12H,5-6H2,1-2H3/p+1 |
| InChIKey | SEBSCXLWNCIHNW-UHFFFAOYSA-O |
| XLogP | 1.01 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium (CID 4172110) is 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium is COc1ccc(C2[NH2+]CCS2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium?
The InChIKey is SEBSCXLWNCIHNW-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H15NO2S/c1-13-9-4-3-8(7-10(9)14-2)11-12-5-6-15-11/h3-4,7,11-12H,5-6H2,1-2H3/p+1.
What are the key properties of 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium?
2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium has a molecular weight of 226.32 g/mol, XLogP of 1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium is sourced from PubChem (CID 4172110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).