C17H27NO — CID 4172562
2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidine (PubChem CID 4172562) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidine |
|---|---|
| PubChem CID | 4172562 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidine |
| SMILES | CC(ON1C(C)(C)CCCC1(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H27NO/c1-14(15-10-7-6-8-11-15)19-18-16(2,3)12-9-13-17(18,4)5/h6-8,10-11,14H,9,12-13H2,1-5H3 |
| InChIKey | WURBRXPDUPECQX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |