C18H38Si4 — CID 4173074
trimethyl-[1,6,6-tris(trimethylsilyl)hexa-1,2,4,5-tetraenyl]silane (PubChem CID 4173074) has the molecular formula C18H38Si4 and a molecular weight of 366.85 g/mol. Its IUPAC name is trimethyl-[1,6,6-tris(trimethylsilyl)hexa-1,2,4,5-tetraenyl]silane.
| Compound Name | trimethyl-[1,6,6-tris(trimethylsilyl)hexa-1,2,4,5-tetraenyl]silane |
|---|---|
| PubChem CID | 4173074 |
| Molecular Formula | C18H38Si4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | trimethyl-[1,6,6-tris(trimethylsilyl)hexa-1,2,4,5-tetraenyl]silane |
| SMILES | C[Si](C)(C)C(=C=CC=C=C([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H38Si4/c1-19(2,3)17(20(4,5)6)15-13-14-16-18(21(7,8)9)22(10,11)12/h13-14H,1-12H3 |
| InChIKey | ZGRFZWDBHVXKJG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|