C21H29N2O+ — CID 4173131
diethyl-[2-oxo-1-phenyl-2-(4-propan-2-ylanilino)ethyl]azanium (PubChem CID 4173131) has the molecular formula C21H29N2O+ and a molecular weight of 325.48 g/mol. Its IUPAC name is diethyl-[2-oxo-1-phenyl-2-(4-propan-2-ylanilino)ethyl]azanium.
| Compound Name | diethyl-[2-oxo-1-phenyl-2-(4-propan-2-ylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 4173131 |
| Molecular Formula | C21H29N2O+ |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | diethyl-[2-oxo-1-phenyl-2-(4-propan-2-ylanilino)ethyl]azanium |
| SMILES | CC[NH+](CC)C(C(=O)Nc1ccc(C(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H28N2O/c1-5-23(6-2)20(18-10-8-7-9-11-18)21(24)22-19-14-12-17(13-15-19)16(3)4/h7-16,20H,5-6H2,1-4H3,(H,22,24)/p+1 |
| InChIKey | CQNIOTWXQDXZCG-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |