C12H23N — CID 4173691
N-butan-2-ylocta-2,7-dien-1-amine (PubChem CID 4173691) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N-butan-2-ylocta-2,7-dien-1-amine.
| Compound Name | N-butan-2-ylocta-2,7-dien-1-amine |
|---|---|
| PubChem CID | 4173691 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N-butan-2-ylocta-2,7-dien-1-amine |
| SMILES | C=CCCCC=CCNC(C)CC |
| InChI | InChI=1S/C12H23N/c1-4-6-7-8-9-10-11-13-12(3)5-2/h4,9-10,12-13H,1,5-8,11H2,2-3H3 |
| InChIKey | VEOJJUCIWAZUAP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|