About 5-chloro-N-(2,4-dioxo-1H-pyrimidin-6-yl)-2-methoxybenzamide
5-chloro-N-(2,4-dioxo-1H-pyrimidin-6-yl)-2-methoxybenzamide (PubChem CID 4173907) has the molecular formula C12H10ClN3O4
and a molecular weight of 295.68 g/mol. Its IUPAC name is 5-chloro-N-(2,4-dioxo-1H-pyrimidin-6-yl)-2-methoxybenzamide.
Molecular Properties
| Compound Name | 5-chloro-N-(2,4-dioxo-1H-pyrimidin-6-yl)-2-methoxybenzamide |
| PubChem CID | 4173907 |
| Molecular Formula | C12H10ClN3O4 |
| Molecular Weight | 295.68 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 5-chloro-N-(2,4-dioxo-1H-pyrimidin-6-yl)-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)Nc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C12H10ClN3O4/c1-20-8-3-2-6(13)4-7(8)11(18)14-9-5-10(17)16-12(19)15-9/h2-5H,1H3,(H3,14,15,16,17,18,19) |
| InChIKey | DDBPHMMPEBACHP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.68 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-N-(2,4-dioxo-1H-pyrimidin-6-yl)-2-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(2,4-dioxo-1H-pyrimidin-6-yl)-2-methoxybenzamide?
The IUPAC name of 5-chloro-N-(2,4-dioxo-1H-pyrimidin-6-yl)-2-methoxybenzamide (CID 4173907) is 5-chloro-N-(2,4-dioxo-1H-pyrimidin-6-yl)-2-methoxybenzamide.
What is the SMILES notation for 5-chloro-N-(2,4-dioxo-1H-pyrimidin-6-yl)-2-methoxybenzamide?
The canonical SMILES for 5-chloro-N-(2,4-dioxo-1H-pyrimidin-6-yl)-2-methoxybenzamide is COc1ccc(Cl)cc1C(=O)Nc1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of 5-chloro-N-(2,4-dioxo-1H-pyrimidin-6-yl)-2-methoxybenzamide?
The InChIKey is DDBPHMMPEBACHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN3O4/c1-20-8-3-2-6(13)4-7(8)11(18)14-9-5-10(17)16-12(19)15-9/h2-5H,1H3,(H3,14,15,16,17,18,19).
What are the key properties of 5-chloro-N-(2,4-dioxo-1H-pyrimidin-6-yl)-2-methoxybenzamide?
5-chloro-N-(2,4-dioxo-1H-pyrimidin-6-yl)-2-methoxybenzamide has a molecular weight of 295.68 g/mol, XLogP of 0.98, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(2,4-dioxo-1H-pyrimidin-6-yl)-2-methoxybenzamide is sourced from PubChem (CID 4173907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).