C35H27Cl2FN2O8 — CID 4174435
3-[8-(3-chloro-4-fluorophenyl)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid (PubChem CID 4174435) has the molecular formula C35H27Cl2FN2O8 and a molecular weight of 693.51 g/mol. Its IUPAC name is 3-[8-(3-chloro-4-fluorophenyl)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[8-(3-chloro-4-fluorophenyl)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 4174435 |
| Molecular Formula | C35H27Cl2FN2O8 |
| Molecular Weight | 693.51 g/mol |
| Exact Mass | 692.11 |
| IUPAC Name | 3-[8-(3-chloro-4-fluorophenyl)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5cccc(C(=O)O)c5)C(=O)C4C3CC3C(=O)N(c4ccc(F)c(Cl)c4)C(=O)C32C)cc(Cl)c1O |
| InChI | InChI=1S/C35H27Cl2FN2O8/c1-35-22(31(43)40(34(35)47)18-6-9-25(38)23(36)13-18)14-21-19(28(35)16-11-24(37)29(41)26(12-16)48-2)7-8-20-27(21)32(44)39(30(20)42)17-5-3-4-15(10-17)33(45)46/h3-7,9-13,20-22,27-28,41H,8,14H2,1-2H3,(H,45,46) |
| InChIKey | NNZZNSZSDZXKCJ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|