C43H48ClFN2O4S — CID 4174714
1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-(2-thiophen-2-ylethyl)urea (PubChem CID 4174714) has the molecular formula C43H48ClFN2O4S and a molecular weight of 743.39 g/mol. Its IUPAC name is 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 4174714 |
| Molecular Formula | C43H48ClFN2O4S |
| Molecular Weight | 743.39 g/mol |
| Exact Mass | 742.30 |
| IUPAC Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-(2-thiophen-2-ylethyl)urea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)C(=O)Nc2ccccc2)c2ccc(cc2C(=O)Cc2c(F)cccc2Cl)CC(O)CC1 |
| InChI | InChI=1S/C43H48ClFN2O4S/c1-29-9-7-21-42(2)37(19-22-43(42,51)28-47(23-20-33-12-8-24-52-33)41(50)46-31-10-4-3-5-11-31)34-18-16-30(25-32(48)17-15-29)26-35(34)40(49)27-36-38(44)13-6-14-39(36)45/h3-6,8-14,16,18,24,26,32,37,48,51H,7,15,17,19-23,25,27-28H2,1-2H3,(H,46,50) |
| InChIKey | KXAUPRWHHMNHQB-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.39 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|