About 3-chloropropanimidamide
3-chloropropanimidamide (PubChem CID 4174774) has the molecular formula C3H7ClN2
and a molecular weight of 106.56 g/mol. Its IUPAC name is 3-chloropropanimidamide.
Molecular Properties
| Compound Name | 3-chloropropanimidamide |
| PubChem CID | 4174774 |
| Molecular Formula | C3H7ClN2 |
| Molecular Weight | 106.56 g/mol |
| Exact Mass | 106.03 |
| IUPAC Name | 3-chloropropanimidamide |
| SMILES | [H]/N=C(/N)CCCl |
| InChI | InChI=1S/C3H7ClN2/c4-2-1-3(5)6/h1-2H2,(H3,5,6) |
| InChIKey | ZHBRTGUYTVCERJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.56 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropropanimidamide?
The IUPAC name of 3-chloropropanimidamide (CID 4174774) is 3-chloropropanimidamide.
What is the SMILES notation for 3-chloropropanimidamide?
The canonical SMILES for 3-chloropropanimidamide is [H]/N=C(/N)CCCl.
What is the InChIKey of 3-chloropropanimidamide?
The InChIKey is ZHBRTGUYTVCERJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7ClN2/c4-2-1-3(5)6/h1-2H2,(H3,5,6).
What are the key properties of 3-chloropropanimidamide?
3-chloropropanimidamide has a molecular weight of 106.56 g/mol, XLogP of 0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropropanimidamide is sourced from PubChem (CID 4174774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).