C33H25NO5 — CID 4175163
3-(1-benzofuran-2-carbonyl)-1-benzyl-4-hydroxy-2-(4-phenylmethoxyphenyl)-2H-pyrrol-5-one (PubChem CID 4175163) has the molecular formula C33H25NO5 and a molecular weight of 515.57 g/mol. Its IUPAC name is 3-(1-benzofuran-2-carbonyl)-1-benzyl-4-hydroxy-2-(4-phenylmethoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 3-(1-benzofuran-2-carbonyl)-1-benzyl-4-hydroxy-2-(4-phenylmethoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4175163 |
| Molecular Formula | C33H25NO5 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 3-(1-benzofuran-2-carbonyl)-1-benzyl-4-hydroxy-2-(4-phenylmethoxyphenyl)-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(Cc2ccccc2)C1c1ccc(OCc2ccccc2)cc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C33H25NO5/c35-31(28-19-25-13-7-8-14-27(25)39-28)29-30(34(33(37)32(29)36)20-22-9-3-1-4-10-22)24-15-17-26(18-16-24)38-21-23-11-5-2-6-12-23/h1-19,30,36H,20-21H2 |
| InChIKey | OVMYEZKEGRYSKD-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |