C14H9Cl2N3O2S — CID 4175418
3-(2,4-dichloroanilino)-2-pyridin-2-ylsulfonylprop-2-enenitrile (PubChem CID 4175418) has the molecular formula C14H9Cl2N3O2S and a molecular weight of 354.22 g/mol. Its IUPAC name is 3-(2,4-dichloroanilino)-2-pyridin-2-ylsulfonylprop-2-enenitrile.
| Compound Name | 3-(2,4-dichloroanilino)-2-pyridin-2-ylsulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 4175418 |
| Molecular Formula | C14H9Cl2N3O2S |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 3-(2,4-dichloroanilino)-2-pyridin-2-ylsulfonylprop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(Cl)cc1Cl)S(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C14H9Cl2N3O2S/c15-10-4-5-13(12(16)7-10)19-9-11(8-17)22(20,21)14-3-1-2-6-18-14/h1-7,9,19H |
| InChIKey | SEKRCOWEOZNDEO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|