C20H18F8NO3P — CID 4175596
ethyl N-(1-diphenylphosphoryl-2,2,3,3,4,4,5,5-octafluoropentyl)carbamate (PubChem CID 4175596) has the molecular formula C20H18F8NO3P and a molecular weight of 503.33 g/mol. Its IUPAC name is ethyl N-(1-diphenylphosphoryl-2,2,3,3,4,4,5,5-octafluoropentyl)carbamate.
| Compound Name | ethyl N-(1-diphenylphosphoryl-2,2,3,3,4,4,5,5-octafluoropentyl)carbamate |
|---|---|
| PubChem CID | 4175596 |
| Molecular Formula | C20H18F8NO3P |
| Molecular Weight | 503.33 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | ethyl N-(1-diphenylphosphoryl-2,2,3,3,4,4,5,5-octafluoropentyl)carbamate |
| SMILES | CCOC(=O)NC(C(F)(F)C(F)(F)C(F)(F)C(F)F)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18F8NO3P/c1-2-32-17(30)29-16(19(25,26)20(27,28)18(23,24)15(21)22)33(31,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15-16H,2H2,1H3,(H,29,30) |
| InChIKey | HOJHMVPIJPIFPX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.33 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|