C24H28N2O4 — CID 4176277
[4,4,5'-trimethyl-4'-(4-methylphenyl)-2-oxospiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-7'-yl] acetate (PubChem CID 4176277) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is [4,4,5'-trimethyl-4'-(4-methylphenyl)-2-oxospiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-7'-yl] acetate.
| Compound Name | [4,4,5'-trimethyl-4'-(4-methylphenyl)-2-oxospiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-7'-yl] acetate |
|---|---|
| PubChem CID | 4176277 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [4,4,5'-trimethyl-4'-(4-methylphenyl)-2-oxospiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-7'-yl] acetate |
| SMILES | CC(=O)Oc1cc(C)c2c(c1)OC1(CC2c2ccc(C)cc2)CC(C)(C)NC(=O)N1 |
| InChI | InChI=1S/C24H28N2O4/c1-14-6-8-17(9-7-14)19-12-24(13-23(4,5)25-22(28)26-24)30-20-11-18(29-16(3)27)10-15(2)21(19)20/h6-11,19H,12-13H2,1-5H3,(H2,25,26,28) |
| InChIKey | ROHIRBUDXGDSDM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|