C24H25ClF2N4O4S — CID 4176341
3-amino-5-(4-chlorophenyl)imino-2-N-[4-(difluoromethoxy)phenyl]-4-N-(3-ethoxypropyl)-2H-thiophene-2,4-dicarboxamide (PubChem CID 4176341) has the molecular formula C24H25ClF2N4O4S and a molecular weight of 539.00 g/mol. Its IUPAC name is 3-amino-5-(4-chlorophenyl)imino-2-N-[4-(difluoromethoxy)phenyl]-4-N-(3-ethoxypropyl)-2H-thiophene-2,4-dicarboxamide.
| Compound Name | 3-amino-5-(4-chlorophenyl)imino-2-N-[4-(difluoromethoxy)phenyl]-4-N-(3-ethoxypropyl)-2H-thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 4176341 |
| Molecular Formula | C24H25ClF2N4O4S |
| Molecular Weight | 539.00 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 3-amino-5-(4-chlorophenyl)imino-2-N-[4-(difluoromethoxy)phenyl]-4-N-(3-ethoxypropyl)-2H-thiophene-2,4-dicarboxamide |
| SMILES | CCOCCCNC(=O)C1=C(N)C(C(=O)Nc2ccc(OC(F)F)cc2)S/C1=N\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H25ClF2N4O4S/c1-2-34-13-3-12-29-21(32)18-19(28)20(36-23(18)31-16-6-4-14(25)5-7-16)22(33)30-15-8-10-17(11-9-15)35-24(26)27/h4-11,20,24H,2-3,12-13,28H2,1H3,(H,29,32)(H,30,33)/b31-23- |
| InChIKey | UXAFCUNYGDBYMH-SXBRIOAWSA-N |
| XLogP | 4.48 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.00 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|