C12H11Cl3N2OS — CID 4176375
2-chloro-1-[2-[(2,4-dichlorophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]ethanone (PubChem CID 4176375) has the molecular formula C12H11Cl3N2OS and a molecular weight of 337.66 g/mol. Its IUPAC name is 2-chloro-1-[2-[(2,4-dichlorophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]ethanone.
| Compound Name | 2-chloro-1-[2-[(2,4-dichlorophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]ethanone |
|---|---|
| PubChem CID | 4176375 |
| Molecular Formula | C12H11Cl3N2OS |
| Molecular Weight | 337.66 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 2-chloro-1-[2-[(2,4-dichlorophenyl)methylsulfanyl]-4,5-dihydroimidazol-1-yl]ethanone |
| SMILES | O=C(CCl)N1CCN=C1SCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl3N2OS/c13-6-11(18)17-4-3-16-12(17)19-7-8-1-2-9(14)5-10(8)15/h1-2,5H,3-4,6-7H2 |
| InChIKey | PTOVIHGGMRZGDU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.66 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|